C20H15ClF3N3O3 — CID 136500586
[3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 136500586) has the molecular formula C20H15ClF3N3O3 and a molecular weight of 437.81 g/mol. Its IUPAC name is [3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 136500586 |
| Molecular Formula | C20H15ClF3N3O3 |
| Molecular Weight | 437.81 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | [3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N1CCc2[nH]nc(-c3cc(Cl)c(O)cc3O)c2C1 |
| InChI | InChI=1S/C20H15ClF3N3O3/c21-14-7-12(16(28)8-17(14)29)18-13-9-27(5-4-15(13)25-26-18)19(30)10-2-1-3-11(6-10)20(22,23)24/h1-3,6-8,28-29H,4-5,9H2,(H,25,26) |
| InChIKey | YIDMMIWEVLPFGN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |