C13H13F2N7O2 — CID 167923361
3-azido-5-(azidomethyl)-N-[(1R,2R)-4,4-difluoro-2-hydroxycyclopentyl]benzamide (PubChem CID 167923361) has the molecular formula C13H13F2N7O2 and a molecular weight of 337.29 g/mol. Its IUPAC name is 3-azido-5-(azidomethyl)-N-[(1R,2R)-4,4-difluoro-2-hydroxycyclopentyl]benzamide.
| Compound Name | 3-azido-5-(azidomethyl)-N-[(1R,2R)-4,4-difluoro-2-hydroxycyclopentyl]benzamide |
|---|---|
| PubChem CID | 167923361 |
| Molecular Formula | C13H13F2N7O2 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 3-azido-5-(azidomethyl)-N-[(1R,2R)-4,4-difluoro-2-hydroxycyclopentyl]benzamide |
| SMILES | [N-]=[N+]=NCc1cc(N=[N+]=[N-])cc(C(=O)N[C@@H]2CC(F)(F)C[C@H]2O)c1 |
| InChI | InChI=1S/C13H13F2N7O2/c14-13(15)4-10(11(23)5-13)19-12(24)8-1-7(6-18-21-16)2-9(3-8)20-22-17/h1-3,10-11,23H,4-6H2,(H,19,24)/t10-,11-/m1/s1 |
| InChIKey | BVHROYCATDXZBE-GHMZBOCLSA-N |
| XLogP | 3.33 |
| TPSA | 146.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|