C26H36N8O5 — CID 78134011
3-azido-5-(azidomethyl)-N-[11-[3-hydroxy-2-(1-hydroxyethyl)-1-methyl-5-oxo-2H-pyrrol-4-yl]-11-oxoundecyl]benzamide (PubChem CID 78134011) has the molecular formula C26H36N8O5 and a molecular weight of 540.63 g/mol. Its IUPAC name is 3-azido-5-(azidomethyl)-N-[11-[3-hydroxy-2-(1-hydroxyethyl)-1-methyl-5-oxo-2H-pyrrol-4-yl]-11-oxoundecyl]benzamide.
| Compound Name | 3-azido-5-(azidomethyl)-N-[11-[3-hydroxy-2-(1-hydroxyethyl)-1-methyl-5-oxo-2H-pyrrol-4-yl]-11-oxoundecyl]benzamide |
|---|---|
| PubChem CID | 78134011 |
| Molecular Formula | C26H36N8O5 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | 3-azido-5-(azidomethyl)-N-[11-[3-hydroxy-2-(1-hydroxyethyl)-1-methyl-5-oxo-2H-pyrrol-4-yl]-11-oxoundecyl]benzamide |
| SMILES | CC(O)C1C(O)=C(C(=O)CCCCCCCCCCNC(=O)c2cc(CN=[N+]=[N-])cc(N=[N+]=[N-])c2)C(=O)N1C |
| InChI | InChI=1S/C26H36N8O5/c1-17(35)23-24(37)22(26(39)34(23)2)21(36)11-9-7-5-3-4-6-8-10-12-29-25(38)19-13-18(16-30-32-27)14-20(15-19)31-33-28/h13-15,17,23,35,37H,3-12,16H2,1-2H3,(H,29,38) |
| InChIKey | GDOTZMUAPQTPNE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 204.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|