C10H7ClN4O — CID 121205153
2-(azidomethyl)-5-(2-chlorophenyl)-1,3-oxazole (PubChem CID 121205153) has the molecular formula C10H7ClN4O and a molecular weight of 234.65 g/mol. Its IUPAC name is 2-(azidomethyl)-5-(2-chlorophenyl)-1,3-oxazole.
| Compound Name | 2-(azidomethyl)-5-(2-chlorophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 121205153 |
| Molecular Formula | C10H7ClN4O |
| Molecular Weight | 234.65 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-(azidomethyl)-5-(2-chlorophenyl)-1,3-oxazole |
| SMILES | [N-]=[N+]=NCc1ncc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C10H7ClN4O/c11-8-4-2-1-3-7(8)9-5-13-10(16-9)6-14-15-12/h1-5H,6H2 |
| InChIKey | JSHJOKZPYJHGNH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 74.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.65 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|