C17H13ClF2N2O2 — CID 95904187
N-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-(difluoromethoxy)aniline (PubChem CID 95904187) has the molecular formula C17H13ClF2N2O2 and a molecular weight of 350.75 g/mol. Its IUPAC name is N-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-(difluoromethoxy)aniline.
| Compound Name | N-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-(difluoromethoxy)aniline |
|---|---|
| PubChem CID | 95904187 |
| Molecular Formula | C17H13ClF2N2O2 |
| Molecular Weight | 350.75 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | N-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methyl]-4-(difluoromethoxy)aniline |
| SMILES | FC(F)Oc1ccc(NCc2ncc(-c3ccccc3Cl)o2)cc1 |
| InChI | InChI=1S/C17H13ClF2N2O2/c18-14-4-2-1-3-13(14)15-9-22-16(24-15)10-21-11-5-7-12(8-6-11)23-17(19)20/h1-9,17,21H,10H2 |
| InChIKey | SHVFKSYZANTDOF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.75 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|