C11H13NO5 — CID 174850049
2-(2-methyl-2-prop-2-enoyloxypropyl)-1,3-oxazole-5-carboxylic acid (PubChem CID 174850049) has the molecular formula C11H13NO5 and a molecular weight of 239.23 g/mol. Its IUPAC name is 2-(2-methyl-2-prop-2-enoyloxypropyl)-1,3-oxazole-5-carboxylic acid.
| Compound Name | 2-(2-methyl-2-prop-2-enoyloxypropyl)-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 174850049 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-(2-methyl-2-prop-2-enoyloxypropyl)-1,3-oxazole-5-carboxylic acid |
| SMILES | C=CC(=O)OC(C)(C)Cc1ncc(C(=O)O)o1 |
| InChI | InChI=1S/C11H13NO5/c1-4-9(13)17-11(2,3)5-8-12-6-7(16-8)10(14)15/h4,6H,1,5H2,2-3H3,(H,14,15) |
| InChIKey | HCRBZTRPGRMQNM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|