C10H17N3O4 — CID 121205368
6-[bis(2-methoxyethyl)amino]-1H-pyrimidine-2,4-dione (PubChem CID 121205368) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is 6-[bis(2-methoxyethyl)amino]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[bis(2-methoxyethyl)amino]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 121205368 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 6-[bis(2-methoxyethyl)amino]-1H-pyrimidine-2,4-dione |
| SMILES | COCCN(CCOC)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H17N3O4/c1-16-5-3-13(4-6-17-2)8-7-9(14)12-10(15)11-8/h7H,3-6H2,1-2H3,(H2,11,12,14,15) |
| InChIKey | VNJQVQHLDBIGPD-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 87.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |