C11H10ClN3O — CID 121205953
3-[(2-chlorophenyl)methylamino]-1H-pyridazin-6-one (PubChem CID 121205953) has the molecular formula C11H10ClN3O and a molecular weight of 235.67 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methylamino]-1H-pyridazin-6-one.
| Compound Name | 3-[(2-chlorophenyl)methylamino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 121205953 |
| Molecular Formula | C11H10ClN3O |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 3-[(2-chlorophenyl)methylamino]-1H-pyridazin-6-one |
| SMILES | O=c1ccc(NCc2ccccc2Cl)n[nH]1 |
| InChI | InChI=1S/C11H10ClN3O/c12-9-4-2-1-3-8(9)7-13-10-5-6-11(16)15-14-10/h1-6H,7H2,(H,13,14)(H,15,16) |
| InChIKey | VNFAAPJXCPMRNC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |