C5H9F2NO — CID 121207600
2-(2,2-difluorocyclopropyl)oxyethanamine (PubChem CID 121207600) has the molecular formula C5H9F2NO and a molecular weight of 137.13 g/mol. Its IUPAC name is 2-(2,2-difluorocyclopropyl)oxyethanamine.
| Compound Name | 2-(2,2-difluorocyclopropyl)oxyethanamine |
|---|---|
| PubChem CID | 121207600 |
| Molecular Formula | C5H9F2NO |
| Molecular Weight | 137.13 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | 2-(2,2-difluorocyclopropyl)oxyethanamine |
| SMILES | NCCOC1CC1(F)F |
| InChI | InChI=1S/C5H9F2NO/c6-5(7)3-4(5)9-2-1-8/h4H,1-3,8H2 |
| InChIKey | UIAZDWHRUVNAAL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.13 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |