C8H16ClF2NO2 — CID 126845182
2-[2-[(2,2-difluorocyclopropyl)methoxy]ethoxy]ethanamine;hydrochloride (PubChem CID 126845182) has the molecular formula C8H16ClF2NO2 and a molecular weight of 231.67 g/mol. Its IUPAC name is 2-[2-[(2,2-difluorocyclopropyl)methoxy]ethoxy]ethanamine;hydrochloride.
| Compound Name | 2-[2-[(2,2-difluorocyclopropyl)methoxy]ethoxy]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 126845182 |
| Molecular Formula | C8H16ClF2NO2 |
| Molecular Weight | 231.67 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 2-[2-[(2,2-difluorocyclopropyl)methoxy]ethoxy]ethanamine;hydrochloride |
| SMILES | Cl.NCCOCCOCC1CC1(F)F |
| InChI | InChI=1S/C8H15F2NO2.ClH/c9-8(10)5-7(8)6-13-4-3-12-2-1-11;/h7H,1-6,11H2;1H |
| InChIKey | GDFLGSNCOYSBHP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.67 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|