C10H11FN6 — CID 121211002
1-(2-fluoroethyl)-3-pyrazin-2-ylpyrazole-5-carboximidamide (PubChem CID 121211002) has the molecular formula C10H11FN6 and a molecular weight of 234.24 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-3-pyrazin-2-ylpyrazole-5-carboximidamide.
| Compound Name | 1-(2-fluoroethyl)-3-pyrazin-2-ylpyrazole-5-carboximidamide |
|---|---|
| PubChem CID | 121211002 |
| Molecular Formula | C10H11FN6 |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-(2-fluoroethyl)-3-pyrazin-2-ylpyrazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(-c2cnccn2)nn1CCF |
| InChI | InChI=1S/C10H11FN6/c11-1-4-17-9(10(12)13)5-7(16-17)8-6-14-2-3-15-8/h2-3,5-6H,1,4H2,(H3,12,13) |
| InChIKey | YZHNRYBEDQPUKU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|