C18H20BFN4O2 — CID 171111487
2-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-prop-2-ynylpyrazol-3-yl]pyrazine (PubChem CID 171111487) has the molecular formula C18H20BFN4O2 and a molecular weight of 354.19 g/mol. Its IUPAC name is 2-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-prop-2-ynylpyrazol-3-yl]pyrazine.
| Compound Name | 2-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-prop-2-ynylpyrazol-3-yl]pyrazine |
|---|---|
| PubChem CID | 171111487 |
| Molecular Formula | C18H20BFN4O2 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[5-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-prop-2-ynylpyrazol-3-yl]pyrazine |
| SMILES | C#CCn1nc(-c2cnccn2)cc1C=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H20BFN4O2/c1-6-9-24-13(10-14(23-24)15-12-21-7-8-22-15)11-16(20)19-25-17(2,3)18(4,5)26-19/h1,7-8,10-12H,9H2,2-5H3 |
| InChIKey | JUTMSNCGTWYFHI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|