C17H25BFN3O2 — CID 171111778
6-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-(2-methylpropyl)imidazo[2,1-e]pyrazole (PubChem CID 171111778) has the molecular formula C17H25BFN3O2 and a molecular weight of 333.22 g/mol. Its IUPAC name is 6-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-(2-methylpropyl)imidazo[2,1-e]pyrazole.
| Compound Name | 6-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-(2-methylpropyl)imidazo[2,1-e]pyrazole |
|---|---|
| PubChem CID | 171111778 |
| Molecular Formula | C17H25BFN3O2 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 6-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1-(2-methylpropyl)imidazo[2,1-e]pyrazole |
| SMILES | CC(C)Cn1ccn2nc(C=C(F)B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C17H25BFN3O2/c1-12(2)11-21-7-8-22-15(21)10-13(20-22)9-14(19)18-23-16(3,4)17(5,6)24-18/h7-10,12H,11H2,1-6H3 |
| InChIKey | IPYADMXSKUBZKB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 40.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|