C12H16N4 — CID 121212109
(5-propan-2-yl-3-pyridin-2-yl-1H-pyrazol-4-yl)methanamine (PubChem CID 121212109) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is (5-propan-2-yl-3-pyridin-2-yl-1H-pyrazol-4-yl)methanamine.
| Compound Name | (5-propan-2-yl-3-pyridin-2-yl-1H-pyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 121212109 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (5-propan-2-yl-3-pyridin-2-yl-1H-pyrazol-4-yl)methanamine |
| SMILES | CC(C)c1[nH]nc(-c2ccccn2)c1CN |
| InChI | InChI=1S/C12H16N4/c1-8(2)11-9(7-13)12(16-15-11)10-5-3-4-6-14-10/h3-6,8H,7,13H2,1-2H3,(H,15,16) |
| InChIKey | WMMCXAZCOUJSQC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |