C8H13ClN2 — CID 121212823
4-(chloromethyl)-3,5-diethyl-1H-pyrazole (PubChem CID 121212823) has the molecular formula C8H13ClN2 and a molecular weight of 172.66 g/mol. Its IUPAC name is 4-(chloromethyl)-3,5-diethyl-1H-pyrazole.
| Compound Name | 4-(chloromethyl)-3,5-diethyl-1H-pyrazole |
|---|---|
| PubChem CID | 121212823 |
| Molecular Formula | C8H13ClN2 |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 4-(chloromethyl)-3,5-diethyl-1H-pyrazole |
| SMILES | CCc1n[nH]c(CC)c1CCl |
| InChI | InChI=1S/C8H13ClN2/c1-3-7-6(5-9)8(4-2)11-10-7/h3-5H2,1-2H3,(H,10,11) |
| InChIKey | SRSPLKNOLHZOBN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|