C10H15N3 — CID 121212862
3-(3,5-diethyl-1H-pyrazol-4-yl)propanenitrile (PubChem CID 121212862) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-(3,5-diethyl-1H-pyrazol-4-yl)propanenitrile.
| Compound Name | 3-(3,5-diethyl-1H-pyrazol-4-yl)propanenitrile |
|---|---|
| PubChem CID | 121212862 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 3-(3,5-diethyl-1H-pyrazol-4-yl)propanenitrile |
| SMILES | CCc1n[nH]c(CC)c1CCC#N |
| InChI | InChI=1S/C10H15N3/c1-3-9-8(6-5-7-11)10(4-2)13-12-9/h3-6H2,1-2H3,(H,12,13) |
| InChIKey | LKGXQPDMWJBIIT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |