About 1-(cyanomethyl)imidazo[2,1-e]pyrazole-6-carbonitrile
1-(cyanomethyl)imidazo[2,1-e]pyrazole-6-carbonitrile (PubChem CID 121215043) has the molecular formula C8H5N5
and a molecular weight of 171.16 g/mol. Its IUPAC name is 1-(cyanomethyl)imidazo[2,1-e]pyrazole-6-carbonitrile.
Analyze 1-(cyanomethyl)imidazo[2,1-e]pyrazole-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyanomethyl)imidazo[2,1-e]pyrazole-6-carbonitrile?
The IUPAC name of 1-(cyanomethyl)imidazo[2,1-e]pyrazole-6-carbonitrile (CID 121215043) is 1-(cyanomethyl)imidazo[2,1-e]pyrazole-6-carbonitrile.
What is the SMILES notation for 1-(cyanomethyl)imidazo[2,1-e]pyrazole-6-carbonitrile?
The canonical SMILES for 1-(cyanomethyl)imidazo[2,1-e]pyrazole-6-carbonitrile is N#CCn1ccn2nc(C#N)cc12.
What is the InChIKey of 1-(cyanomethyl)imidazo[2,1-e]pyrazole-6-carbonitrile?
The InChIKey is OGAJPRRXEALNPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N5/c9-1-2-12-3-4-13-8(12)5-7(6-10)11-13/h3-5H,2H2.
What are the key properties of 1-(cyanomethyl)imidazo[2,1-e]pyrazole-6-carbonitrile?
1-(cyanomethyl)imidazo[2,1-e]pyrazole-6-carbonitrile has a molecular weight of 171.16 g/mol, XLogP of 0.53, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyanomethyl)imidazo[2,1-e]pyrazole-6-carbonitrile is sourced from PubChem (CID 121215043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).