C10H23NO2Si — CID 121215757
(3R,5S)-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidin-3-ol (PubChem CID 121215757) has the molecular formula C10H23NO2Si and a molecular weight of 217.38 g/mol. Its IUPAC name is (3R,5S)-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 121215757 |
| Molecular Formula | C10H23NO2Si |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (3R,5S)-5-(2-trimethylsilyloxypropan-2-yl)pyrrolidin-3-ol |
| SMILES | CC(C)(O[Si](C)(C)C)[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C10H23NO2Si/c1-10(2,13-14(3,4)5)9-6-8(12)7-11-9/h8-9,11-12H,6-7H2,1-5H3/t8-,9+/m1/s1 |
| InChIKey | CZAUWMSLKNEUEK-BDAKNGLRSA-N |
| XLogP | 1.34 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|