C10H17NO — CID 58790119
(3R,5S)-5-(3,3-dimethylbut-1-ynyl)pyrrolidin-3-ol (PubChem CID 58790119) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (3R,5S)-5-(3,3-dimethylbut-1-ynyl)pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-(3,3-dimethylbut-1-ynyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 58790119 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (3R,5S)-5-(3,3-dimethylbut-1-ynyl)pyrrolidin-3-ol |
| SMILES | CC(C)(C)C#C[C@@H]1C[C@@H](O)CN1 |
| InChI | InChI=1S/C10H17NO/c1-10(2,3)5-4-8-6-9(12)7-11-8/h8-9,11-12H,6-7H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | PYRYSHOFLUJZPJ-RKDXNWHRSA-N |
| XLogP | 0.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|