C12H22N2O2S — CID 58790337
N-[(3R,5S)-5-(3,3-dimethylbut-1-ynyl)pyrrolidin-3-yl]ethanesulfonamide (PubChem CID 58790337) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is N-[(3R,5S)-5-(3,3-dimethylbut-1-ynyl)pyrrolidin-3-yl]ethanesulfonamide.
| Compound Name | N-[(3R,5S)-5-(3,3-dimethylbut-1-ynyl)pyrrolidin-3-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 58790337 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-[(3R,5S)-5-(3,3-dimethylbut-1-ynyl)pyrrolidin-3-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N[C@H]1CN[C@H](C#CC(C)(C)C)C1 |
| InChI | InChI=1S/C12H22N2O2S/c1-5-17(15,16)14-11-8-10(13-9-11)6-7-12(2,3)4/h10-11,13-14H,5,8-9H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | QXWFPFZSJWNRMZ-GHMZBOCLSA-N |
| XLogP | 0.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|