C10H9F3N2O3S — CID 121216030
(2-ethylpyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate (PubChem CID 121216030) has the molecular formula C10H9F3N2O3S and a molecular weight of 294.25 g/mol. Its IUPAC name is (2-ethylpyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate.
| Compound Name | (2-ethylpyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 121216030 |
| Molecular Formula | C10H9F3N2O3S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | (2-ethylpyrazolo[1,5-a]pyridin-4-yl) trifluoromethanesulfonate |
| SMILES | CCc1cc2c(OS(=O)(=O)C(F)(F)F)cccn2n1 |
| InChI | InChI=1S/C10H9F3N2O3S/c1-2-7-6-8-9(4-3-5-15(8)14-7)18-19(16,17)10(11,12)13/h3-6H,2H2,1H3 |
| InChIKey | ROSSVYZHRMAYBU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|