C10H12BN3O3 — CID 121216072
[2-methoxy-5-(1H-1,2,4-triazol-5-ylmethyl)phenyl]boronic acid (PubChem CID 121216072) has the molecular formula C10H12BN3O3 and a molecular weight of 233.04 g/mol. Its IUPAC name is [2-methoxy-5-(1H-1,2,4-triazol-5-ylmethyl)phenyl]boronic acid.
| Compound Name | [2-methoxy-5-(1H-1,2,4-triazol-5-ylmethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 121216072 |
| Molecular Formula | C10H12BN3O3 |
| Molecular Weight | 233.04 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | [2-methoxy-5-(1H-1,2,4-triazol-5-ylmethyl)phenyl]boronic acid |
| SMILES | COc1ccc(Cc2ncn[nH]2)cc1B(O)O |
| InChI | InChI=1S/C10H12BN3O3/c1-17-9-3-2-7(4-8(9)11(15)16)5-10-12-6-13-14-10/h2-4,6,15-16H,5H2,1H3,(H,12,13,14) |
| InChIKey | ACCBZPNKEGIDMP-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.04 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|