C10H12BF3O4 — CID 54971116
[2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid (PubChem CID 54971116) has the molecular formula C10H12BF3O4 and a molecular weight of 264.01 g/mol. Its IUPAC name is [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid.
| Compound Name | [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 54971116 |
| Molecular Formula | C10H12BF3O4 |
| Molecular Weight | 264.01 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid |
| SMILES | COc1ccc(COCC(F)(F)F)cc1B(O)O |
| InChI | InChI=1S/C10H12BF3O4/c1-17-9-3-2-7(4-8(9)11(15)16)5-18-6-10(12,13)14/h2-4,15-16H,5-6H2,1H3 |
| InChIKey | YEHMRMOKFQEQPL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.01 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|