[2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid

C10H12BF3O4 — CID 54971116

IUPAC[2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid
SMILESCOc1ccc(COCC(F)(F)F)cc1B(O)O
InChIInChI=1S/C10H12BF3O4/c1-17-9-3-2-7(4-8(9)11(15)16)5-18-6-10(12,13)14/h2-4,15-16H,5-6H2,1H3
InChIKeyYEHMRMOKFQEQPL-UHFFFAOYSA-N
MW264.01 g/mol
LogP0.45
Rot. Bonds5

About [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid

[2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid (PubChem CID 54971116) has the molecular formula C10H12BF3O4 and a molecular weight of 264.01 g/mol. Its IUPAC name is [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid.

Molecular Properties

Compound Name[2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid
PubChem CID54971116
Molecular FormulaC10H12BF3O4
Molecular Weight264.01 g/mol
Exact Mass264.08
IUPAC Name[2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid
SMILESCOc1ccc(COCC(F)(F)F)cc1B(O)O
InChIInChI=1S/C10H12BF3O4/c1-17-9-3-2-7(4-8(9)11(15)16)5-18-6-10(12,13)14/h2-4,15-16H,5-6H2,1H3
InChIKeyYEHMRMOKFQEQPL-UHFFFAOYSA-N
XLogP0.45
TPSA58.92 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.01
LogP ≤ 50.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid?
The IUPAC name of [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid (CID 54971116) is [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid.
What is the SMILES notation for [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid?
The canonical SMILES for [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid is COc1ccc(COCC(F)(F)F)cc1B(O)O.
What is the InChIKey of [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid?
The InChIKey is YEHMRMOKFQEQPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BF3O4/c1-17-9-3-2-7(4-8(9)11(15)16)5-18-6-10(12,13)14/h2-4,15-16H,5-6H2,1H3.
What are the key properties of [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid?
[2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid has a molecular weight of 264.01 g/mol, XLogP of 0.45, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methoxy-5-(2,2,2-trifluoroethoxymethyl)phenyl]boronic acid is sourced from PubChem (CID 54971116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).