C10H16ClNO2S — CID 121216127
(2R,3S)-2-amino-3-phenylbutanethioic S-acid;hydrate;hydrochloride (PubChem CID 121216127) has the molecular formula C10H16ClNO2S and a molecular weight of 249.76 g/mol. Its IUPAC name is (2R,3S)-2-amino-3-phenylbutanethioic S-acid;hydrate;hydrochloride.
| Compound Name | (2R,3S)-2-amino-3-phenylbutanethioic S-acid;hydrate;hydrochloride |
|---|---|
| PubChem CID | 121216127 |
| Molecular Formula | C10H16ClNO2S |
| Molecular Weight | 249.76 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (2R,3S)-2-amino-3-phenylbutanethioic S-acid;hydrate;hydrochloride |
| SMILES | C[C@@H](c1ccccc1)[C@@H](N)C(=O)S.Cl.O |
| InChI | InChI=1S/C10H13NOS.ClH.H2O/c1-7(9(11)10(12)13)8-5-3-2-4-6-8;;/h2-7,9H,11H2,1H3,(H,12,13);1H;1H2/t7-,9+;;/m0../s1 |
| InChIKey | ZFFJUYGWJVSRSF-CJGWJYNLSA-N |
| XLogP | 1.17 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.76 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|