C11H10Br2N4 — CID 121220517
N,N'-bis(5-bromo-2-pyridinyl)methanediamine (PubChem CID 121220517) has the molecular formula C11H10Br2N4 and a molecular weight of 358.04 g/mol. Its IUPAC name is N,N'-bis(5-bromo-2-pyridinyl)methanediamine.
| Compound Name | N,N'-bis(5-bromo-2-pyridinyl)methanediamine |
|---|---|
| PubChem CID | 121220517 |
| Molecular Formula | C11H10Br2N4 |
| Molecular Weight | 358.04 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | N,N'-bis(5-bromo-2-pyridinyl)methanediamine |
| SMILES | Brc1ccc(NCNc2ccc(Br)cn2)nc1 |
| InChI | InChI=1S/C11H10Br2N4/c12-8-1-3-10(14-5-8)16-7-17-11-4-2-9(13)6-15-11/h1-6H,7H2,(H,14,16)(H,15,17) |
| InChIKey | BMJNWUNDBVUUKG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.04 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|