C11H10N4O3 — CID 121222993
(4,5-dimethyltriazol-1-yl)-(3-nitrophenyl)methanone (PubChem CID 121222993) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is (4,5-dimethyltriazol-1-yl)-(3-nitrophenyl)methanone.
| Compound Name | (4,5-dimethyltriazol-1-yl)-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 121222993 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | (4,5-dimethyltriazol-1-yl)-(3-nitrophenyl)methanone |
| SMILES | Cc1nnn(C(=O)c2cccc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C11H10N4O3/c1-7-8(2)14(13-12-7)11(16)9-4-3-5-10(6-9)15(17)18/h3-6H,1-2H3 |
| InChIKey | KKFDXBJLZHEIJT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|