C11H15N5O2 — CID 121223000
2-amino-6,8-dimethyl-4-propan-2-yloxypteridin-7-one (PubChem CID 121223000) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-amino-6,8-dimethyl-4-propan-2-yloxypteridin-7-one.
| Compound Name | 2-amino-6,8-dimethyl-4-propan-2-yloxypteridin-7-one |
|---|---|
| PubChem CID | 121223000 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-amino-6,8-dimethyl-4-propan-2-yloxypteridin-7-one |
| SMILES | Cc1nc2c(OC(C)C)nc(N)nc2n(C)c1=O |
| InChI | InChI=1S/C11H15N5O2/c1-5(2)18-9-7-8(14-11(12)15-9)16(4)10(17)6(3)13-7/h5H,1-4H3,(H2,12,14,15) |
| InChIKey | NRBRWJALLVRRDZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |