C12H17N5O3 — CID 171383937
2-amino-8-(2-hydroxyethyl)-6-methyl-4-propan-2-yloxypteridin-7-one (PubChem CID 171383937) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-amino-8-(2-hydroxyethyl)-6-methyl-4-propan-2-yloxypteridin-7-one.
| Compound Name | 2-amino-8-(2-hydroxyethyl)-6-methyl-4-propan-2-yloxypteridin-7-one |
|---|---|
| PubChem CID | 171383937 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-amino-8-(2-hydroxyethyl)-6-methyl-4-propan-2-yloxypteridin-7-one |
| SMILES | Cc1nc2c(OC(C)C)nc(N)nc2n(CCO)c1=O |
| InChI | InChI=1S/C12H17N5O3/c1-6(2)20-10-8-9(15-12(13)16-10)17(4-5-18)11(19)7(3)14-8/h6,18H,4-5H2,1-3H3,(H2,13,15,16) |
| InChIKey | SXJRKZKMRISABM-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |