C11H13N3O — CID 121223739
7-methoxy-2,3,5,10-tetrahydroimidazo[2,1-b]quinazoline (PubChem CID 121223739) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 7-methoxy-2,3,5,10-tetrahydroimidazo[2,1-b]quinazoline.
| Compound Name | 7-methoxy-2,3,5,10-tetrahydroimidazo[2,1-b]quinazoline |
|---|---|
| PubChem CID | 121223739 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 7-methoxy-2,3,5,10-tetrahydroimidazo[2,1-b]quinazoline |
| SMILES | COc1ccc2c(c1)CN1CCN=C1N2 |
| InChI | InChI=1S/C11H13N3O/c1-15-9-2-3-10-8(6-9)7-14-5-4-12-11(14)13-10/h2-3,6H,4-5,7H2,1H3,(H,12,13) |
| InChIKey | VKLBYMAYLCTNBW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |