C11H11N3O — CID 138491836
9-methoxy-2,3-dihydroimidazo[1,2-c]quinazoline (PubChem CID 138491836) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 9-methoxy-2,3-dihydroimidazo[1,2-c]quinazoline.
| Compound Name | 9-methoxy-2,3-dihydroimidazo[1,2-c]quinazoline |
|---|---|
| PubChem CID | 138491836 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 9-methoxy-2,3-dihydroimidazo[1,2-c]quinazoline |
| SMILES | COc1ccc2c(c1)C1=NCCN1C=N2 |
| InChI | InChI=1S/C11H11N3O/c1-15-8-2-3-10-9(6-8)11-12-4-5-14(11)7-13-10/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | RHJRSJCFLOFVAE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |