C11H14O3 — CID 121224281
1-methyl-4-prop-2-enyl-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione (PubChem CID 121224281) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-methyl-4-prop-2-enyl-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione.
| Compound Name | 1-methyl-4-prop-2-enyl-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione |
|---|---|
| PubChem CID | 121224281 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-methyl-4-prop-2-enyl-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]furan-3,5-dione |
| SMILES | C=CCC1C(=O)CC2C(C)OC(=O)C12 |
| InChI | InChI=1S/C11H14O3/c1-3-4-7-9(12)5-8-6(2)14-11(13)10(7)8/h3,6-8,10H,1,4-5H2,2H3 |
| InChIKey | QHLZXZNJVRSMKQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|