C12H14O3 — CID 134963704
(1S,4R,6S,7S,11S)-6-ethenyl-2-oxatricyclo[5.3.1.04,11]undecane-3,8-dione (PubChem CID 134963704) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (1S,4R,6S,7S,11S)-6-ethenyl-2-oxatricyclo[5.3.1.04,11]undecane-3,8-dione.
| Compound Name | (1S,4R,6S,7S,11S)-6-ethenyl-2-oxatricyclo[5.3.1.04,11]undecane-3,8-dione |
|---|---|
| PubChem CID | 134963704 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (1S,4R,6S,7S,11S)-6-ethenyl-2-oxatricyclo[5.3.1.04,11]undecane-3,8-dione |
| SMILES | C=C[C@@H]1C[C@H]2C(=O)O[C@H]3CCC(=O)[C@@H]1[C@H]32 |
| InChI | InChI=1S/C12H14O3/c1-2-6-5-7-11-9(15-12(7)14)4-3-8(13)10(6)11/h2,6-7,9-11H,1,3-5H2/t6-,7-,9+,10-,11+/m1/s1 |
| InChIKey | ZWJBSVGQSPGXRK-YAOIVLIJSA-N |
| XLogP | 1.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|