C11H17NO2 — CID 121224817
ethyl 4-prop-2-enyl-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 121224817) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is ethyl 4-prop-2-enyl-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | ethyl 4-prop-2-enyl-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 121224817 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | ethyl 4-prop-2-enyl-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=CCC1C=CN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C11H17NO2/c1-3-5-10-6-8-12(9-7-10)11(13)14-4-2/h3,6,8,10H,1,4-5,7,9H2,2H3 |
| InChIKey | PQFOPIVKNIHTAL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|