C15H25NO2 — CID 137457943
ethyl N-ethenyl-N-[(6E)-5-methylnona-6,8-dienyl]carbamate (PubChem CID 137457943) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is ethyl N-ethenyl-N-[(6E)-5-methylnona-6,8-dienyl]carbamate.
| Compound Name | ethyl N-ethenyl-N-[(6E)-5-methylnona-6,8-dienyl]carbamate |
|---|---|
| PubChem CID | 137457943 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | ethyl N-ethenyl-N-[(6E)-5-methylnona-6,8-dienyl]carbamate |
| SMILES | C=C/C=C/C(C)CCCCN(C=C)C(=O)OCC |
| InChI | InChI=1S/C15H25NO2/c1-5-8-11-14(4)12-9-10-13-16(6-2)15(17)18-7-3/h5-6,8,11,14H,1-2,7,9-10,12-13H2,3-4H3/b11-8+ |
| InChIKey | ZZXUVYYOZMPKCZ-DHZHZOJOSA-N |
| XLogP | 4.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|