C24H23FN4O — CID 121224989
[4-[6-[4-(6-fluoroindol-1-yl)piperidin-1-yl]pyridazin-3-yl]phenyl]methanol (PubChem CID 121224989) has the molecular formula C24H23FN4O and a molecular weight of 402.47 g/mol. Its IUPAC name is [4-[6-[4-(6-fluoroindol-1-yl)piperidin-1-yl]pyridazin-3-yl]phenyl]methanol.
| Compound Name | [4-[6-[4-(6-fluoroindol-1-yl)piperidin-1-yl]pyridazin-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 121224989 |
| Molecular Formula | C24H23FN4O |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [4-[6-[4-(6-fluoroindol-1-yl)piperidin-1-yl]pyridazin-3-yl]phenyl]methanol |
| SMILES | OCc1ccc(-c2ccc(N3CCC(n4ccc5ccc(F)cc54)CC3)nn2)cc1 |
| InChI | InChI=1S/C24H23FN4O/c25-20-6-5-19-9-14-29(23(19)15-20)21-10-12-28(13-11-21)24-8-7-22(26-27-24)18-3-1-17(16-30)2-4-18/h1-9,14-15,21,30H,10-13,16H2 |
| InChIKey | XLVWQBLLHTWXIH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |