C18H19FN6 — CID 133412730
3-(4-fluorophenyl)-6-[4-(triazol-1-ylmethyl)piperidin-1-yl]pyridazine (PubChem CID 133412730) has the molecular formula C18H19FN6 and a molecular weight of 338.39 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-6-[4-(triazol-1-ylmethyl)piperidin-1-yl]pyridazine.
| Compound Name | 3-(4-fluorophenyl)-6-[4-(triazol-1-ylmethyl)piperidin-1-yl]pyridazine |
|---|---|
| PubChem CID | 133412730 |
| Molecular Formula | C18H19FN6 |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-(4-fluorophenyl)-6-[4-(triazol-1-ylmethyl)piperidin-1-yl]pyridazine |
| SMILES | Fc1ccc(-c2ccc(N3CCC(Cn4ccnn4)CC3)nn2)cc1 |
| InChI | InChI=1S/C18H19FN6/c19-16-3-1-15(2-4-16)17-5-6-18(22-21-17)24-10-7-14(8-11-24)13-25-12-9-20-23-25/h1-6,9,12,14H,7-8,10-11,13H2 |
| InChIKey | XUCWFJUDQWMGLC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |