C43H46N2O3 — CID 121225455
2,6-bis[[(2S)-1-[hydroxy(diphenyl)methyl]pyrrolidin-2-yl]methyl]-4-methylphenol (PubChem CID 121225455) has the molecular formula C43H46N2O3 and a molecular weight of 638.85 g/mol. Its IUPAC name is 2,6-bis[[(2S)-1-[hydroxy(diphenyl)methyl]pyrrolidin-2-yl]methyl]-4-methylphenol.
| Compound Name | 2,6-bis[[(2S)-1-[hydroxy(diphenyl)methyl]pyrrolidin-2-yl]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 121225455 |
| Molecular Formula | C43H46N2O3 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 638.35 |
| IUPAC Name | 2,6-bis[[(2S)-1-[hydroxy(diphenyl)methyl]pyrrolidin-2-yl]methyl]-4-methylphenol |
| SMILES | Cc1cc(C[C@@H]2CCCN2C(O)(c2ccccc2)c2ccccc2)c(O)c(C[C@@H]2CCCN2C(O)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C43H46N2O3/c1-32-28-33(30-39-24-14-26-44(39)42(47,35-16-6-2-7-17-35)36-18-8-3-9-19-36)41(46)34(29-32)31-40-25-15-27-45(40)43(48,37-20-10-4-11-21-37)38-22-12-5-13-23-38/h2-13,16-23,28-29,39-40,46-48H,14-15,24-27,30-31H2,1H3/t39-,40-/m0/s1 |
| InChIKey | SQYBULWMQKFRPK-ZAQUEYBZSA-N |
| XLogP | 7.50 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |