C42H43FN2O3 — CID 102270483
4-fluoro-2,6-bis[[(2R)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]methyl]phenol (PubChem CID 102270483) has the molecular formula C42H43FN2O3 and a molecular weight of 642.82 g/mol. Its IUPAC name is 4-fluoro-2,6-bis[[(2R)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]methyl]phenol.
| Compound Name | 4-fluoro-2,6-bis[[(2R)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 102270483 |
| Molecular Formula | C42H43FN2O3 |
| Molecular Weight | 642.82 g/mol |
| Exact Mass | 642.33 |
| IUPAC Name | 4-fluoro-2,6-bis[[(2R)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]methyl]phenol |
| SMILES | Oc1c(CN2CCC[C@@H]2C(O)(c2ccccc2)c2ccccc2)cc(F)cc1CN1CCC[C@@H]1C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H43FN2O3/c43-37-27-31(29-44-25-13-23-38(44)41(47,33-15-5-1-6-16-33)34-17-7-2-8-18-34)40(46)32(28-37)30-45-26-14-24-39(45)42(48,35-19-9-3-10-20-35)36-21-11-4-12-22-36/h1-12,15-22,27-28,38-39,46-48H,13-14,23-26,29-30H2/t38-,39-/m1/s1 |
| InChIKey | GTSIVJKQRBKVFS-LJEWAXOPSA-N |
| XLogP | 7.33 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.82 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|