C27H22F9NO2 — CID 155896652
2-[[2-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl]methyl]-6-(trifluoromethyl)phenol (PubChem CID 155896652) has the molecular formula C27H22F9NO2 and a molecular weight of 563.46 g/mol. Its IUPAC name is 2-[[2-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl]methyl]-6-(trifluoromethyl)phenol.
| Compound Name | 2-[[2-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl]methyl]-6-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 155896652 |
| Molecular Formula | C27H22F9NO2 |
| Molecular Weight | 563.46 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 2-[[2-[hydroxy-bis[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-1-yl]methyl]-6-(trifluoromethyl)phenol |
| SMILES | Oc1c(CN2CCCC2C(O)(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)cccc1C(F)(F)F |
| InChI | InChI=1S/C27H22F9NO2/c28-25(29,30)19-10-6-17(7-11-19)24(39,18-8-12-20(13-9-18)26(31,32)33)22-5-2-14-37(22)15-16-3-1-4-21(23(16)38)27(34,35)36/h1,3-4,6-13,22,38-39H,2,5,14-15H2 |
| InChIKey | LINPZJJKBWDYRS-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.46 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|