C21H17BrFN3O3S — CID 121225773
4-[3-(5-bromo-2-hydroxyphenyl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonamide (PubChem CID 121225773) has the molecular formula C21H17BrFN3O3S and a molecular weight of 490.35 g/mol. Its IUPAC name is 4-[3-(5-bromo-2-hydroxyphenyl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonamide.
| Compound Name | 4-[3-(5-bromo-2-hydroxyphenyl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 121225773 |
| Molecular Formula | C21H17BrFN3O3S |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | 4-[3-(5-bromo-2-hydroxyphenyl)-5-(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2N=C(c3ccc(F)cc3)CC2c2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C21H17BrFN3O3S/c22-14-3-10-21(27)18(11-14)20-12-19(13-1-4-15(23)5-2-13)25-26(20)16-6-8-17(9-7-16)30(24,28)29/h1-11,20,27H,12H2,(H2,24,28,29) |
| InChIKey | YMAMXDTXKWPGGB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|