C22H19N3O4S — CID 91969569
2-[5-phenyl-2-(4-sulfamoylphenyl)-3,4-dihydropyrazol-3-yl]benzoic acid (PubChem CID 91969569) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-[5-phenyl-2-(4-sulfamoylphenyl)-3,4-dihydropyrazol-3-yl]benzoic acid.
| Compound Name | 2-[5-phenyl-2-(4-sulfamoylphenyl)-3,4-dihydropyrazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 91969569 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 2-[5-phenyl-2-(4-sulfamoylphenyl)-3,4-dihydropyrazol-3-yl]benzoic acid |
| SMILES | NS(=O)(=O)c1ccc(N2N=C(c3ccccc3)CC2c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C22H19N3O4S/c23-30(28,29)17-12-10-16(11-13-17)25-21(18-8-4-5-9-19(18)22(26)27)14-20(24-25)15-6-2-1-3-7-15/h1-13,21H,14H2,(H,26,27)(H2,23,28,29) |
| InChIKey | DXTJHUASRINHOD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |