C20H21N5O3S — CID 136792294
4-[(3R)-3-(1,3-dimethylpyrazol-4-yl)-5-(4-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonamide (PubChem CID 136792294) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is 4-[(3R)-3-(1,3-dimethylpyrazol-4-yl)-5-(4-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonamide.
| Compound Name | 4-[(3R)-3-(1,3-dimethylpyrazol-4-yl)-5-(4-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 136792294 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 4-[(3R)-3-(1,3-dimethylpyrazol-4-yl)-5-(4-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonamide |
| SMILES | Cc1nn(C)cc1[C@H]1CC(c2ccc(O)cc2)=NN1c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H21N5O3S/c1-13-18(12-24(2)22-13)20-11-19(14-3-7-16(26)8-4-14)23-25(20)15-5-9-17(10-6-15)29(21,27)28/h3-10,12,20,26H,11H2,1-2H3,(H2,21,27,28)/t20-/m1/s1 |
| InChIKey | CKSWZIQWJGPMKQ-HXUWFJFHSA-N |
| XLogP | 2.44 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|