C11H9NO4 — CID 121226651
2,3,8-trihydroxynaphthalene-1-carboxamide (PubChem CID 121226651) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2,3,8-trihydroxynaphthalene-1-carboxamide.
| Compound Name | 2,3,8-trihydroxynaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 121226651 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2,3,8-trihydroxynaphthalene-1-carboxamide |
| SMILES | NC(=O)c1c(O)c(O)cc2cccc(O)c12 |
| InChI | InChI=1S/C11H9NO4/c12-11(16)9-8-5(2-1-3-6(8)13)4-7(14)10(9)15/h1-4,13-15H,(H2,12,16) |
| InChIKey | TWFIEZFWMQGSTN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|