C15H12N2O2 — CID 70377327
3-methyltricyclo[5.3.1.12,6]dodeca-1(10),2(12),3,5,7(11),8-hexaene-4,12-dicarboxamide (PubChem CID 70377327) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-methyltricyclo[5.3.1.12,6]dodeca-1(10),2(12),3,5,7(11),8-hexaene-4,12-dicarboxamide.
| Compound Name | 3-methyltricyclo[5.3.1.12,6]dodeca-1(10),2(12),3,5,7(11),8-hexaene-4,12-dicarboxamide |
|---|---|
| PubChem CID | 70377327 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-methyltricyclo[5.3.1.12,6]dodeca-1(10),2(12),3,5,7(11),8-hexaene-4,12-dicarboxamide |
| SMILES | Cc1c(C(N)=O)cc2c(C(N)=O)c1c1cccc2c1 |
| InChI | InChI=1S/C15H12N2O2/c1-7-10(14(16)18)6-11-8-3-2-4-9(5-8)12(7)13(11)15(17)19/h2-6H,1H3,(H2,16,18)(H2,17,19) |
| InChIKey | HAGCOOWQQFEZKU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |