C12H12N2O — CID 21300607
8-amino-3-methylnaphthalene-2-carboxamide (PubChem CID 21300607) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 8-amino-3-methylnaphthalene-2-carboxamide.
| Compound Name | 8-amino-3-methylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 21300607 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 8-amino-3-methylnaphthalene-2-carboxamide |
| SMILES | Cc1cc2cccc(N)c2cc1C(N)=O |
| InChI | InChI=1S/C12H12N2O/c1-7-5-8-3-2-4-11(13)10(8)6-9(7)12(14)15/h2-6H,13H2,1H3,(H2,14,15) |
| InChIKey | SLCXYRRMERSFLI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|