C15H24ClN3O — CID 121230636
(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-en-1-amine;hydrochloride (PubChem CID 121230636) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is (Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-en-1-amine;hydrochloride.
| Compound Name | (Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 121230636 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-en-1-amine;hydrochloride |
| SMILES | Cl.NC/C=C\COc1cc(CN2CCCCC2)ccn1 |
| InChI | InChI=1S/C15H23N3O.ClH/c16-7-2-5-11-19-15-12-14(6-8-17-15)13-18-9-3-1-4-10-18;/h2,5-6,8,12H,1,3-4,7,9-11,13,16H2;1H/b5-2-; |
| InChIKey | NQIZIEQZWYAWDL-PVOKDAACSA-N |
| XLogP | 2.38 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|