C20H30N4O3 — CID 139915589
N'-[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]pentanediamide (PubChem CID 139915589) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is N'-[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]pentanediamide.
| Compound Name | N'-[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]pentanediamide |
|---|---|
| PubChem CID | 139915589 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N'-[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]pentanediamide |
| SMILES | NC(=O)CCCC(=O)NC/C=C\COc1cc(CN2CCCCC2)ccn1 |
| InChI | InChI=1S/C20H30N4O3/c21-18(25)7-6-8-19(26)22-10-2-5-14-27-20-15-17(9-11-23-20)16-24-12-3-1-4-13-24/h2,5,9,11,15H,1,3-4,6-8,10,12-14,16H2,(H2,21,25)(H,22,26)/b5-2- |
| InChIKey | AGGQIVNKXUDWAZ-DJWKRKHSSA-N |
| XLogP | 1.77 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|