C26H41N5O2S — CID 139652629
4-(cyclohexylcarbamothioylamino)-N-[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]butanamide (PubChem CID 139652629) has the molecular formula C26H41N5O2S and a molecular weight of 487.71 g/mol. Its IUPAC name is 4-(cyclohexylcarbamothioylamino)-N-[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]butanamide.
| Compound Name | 4-(cyclohexylcarbamothioylamino)-N-[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]butanamide |
|---|---|
| PubChem CID | 139652629 |
| Molecular Formula | C26H41N5O2S |
| Molecular Weight | 487.71 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | 4-(cyclohexylcarbamothioylamino)-N-[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]butanamide |
| SMILES | O=C(CCCNC(=S)NC1CCCCC1)NC/C=C\COc1cc(CN2CCCCC2)ccn1 |
| InChI | InChI=1S/C26H41N5O2S/c32-24(12-9-15-29-26(34)30-23-10-3-1-4-11-23)27-14-5-8-19-33-25-20-22(13-16-28-25)21-31-17-6-2-7-18-31/h5,8,13,16,20,23H,1-4,6-7,9-12,14-15,17-19,21H2,(H,27,32)(H2,29,30,34)/b8-5- |
| InChIKey | AATHDTJSQXYNFW-YVMONPNESA-N |
| XLogP | 3.70 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.71 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|