C21H33N3O3S — CID 67725591
4-(2-hydroxyethylsulfanyl)-N-[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]butanamide (PubChem CID 67725591) has the molecular formula C21H33N3O3S and a molecular weight of 407.58 g/mol. Its IUPAC name is 4-(2-hydroxyethylsulfanyl)-N-[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]butanamide.
| Compound Name | 4-(2-hydroxyethylsulfanyl)-N-[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]butanamide |
|---|---|
| PubChem CID | 67725591 |
| Molecular Formula | C21H33N3O3S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 4-(2-hydroxyethylsulfanyl)-N-[(Z)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]butanamide |
| SMILES | O=C(CCCSCCO)NC/C=C\COc1cc(CN2CCCCC2)ccn1 |
| InChI | InChI=1S/C21H33N3O3S/c25-13-16-28-15-6-7-20(26)22-9-2-5-14-27-21-17-19(8-10-23-21)18-24-11-3-1-4-12-24/h2,5,8,10,17,25H,1,3-4,6-7,9,11-16,18H2,(H,22,26)/b5-2- |
| InChIKey | DLQGOEJQJWXQRJ-DJWKRKHSSA-N |
| XLogP | 2.62 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|