C19H27ClN4O3 — CID 166639328
3-amino-4-[[(E)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]amino]cyclobutane-1,2-dione;hydrochloride (PubChem CID 166639328) has the molecular formula C19H27ClN4O3 and a molecular weight of 394.90 g/mol. Its IUPAC name is 3-amino-4-[[(E)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]amino]cyclobutane-1,2-dione;hydrochloride.
| Compound Name | 3-amino-4-[[(E)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]amino]cyclobutane-1,2-dione;hydrochloride |
|---|---|
| PubChem CID | 166639328 |
| Molecular Formula | C19H27ClN4O3 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 3-amino-4-[[(E)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]amino]cyclobutane-1,2-dione;hydrochloride |
| SMILES | Cl.NC1C(=O)C(=O)C1NC/C=C/COc1cc(CN2CCCCC2)ccn1 |
| InChI | InChI=1S/C19H26N4O3.ClH/c20-16-17(19(25)18(16)24)22-7-2-5-11-26-15-12-14(6-8-21-15)13-23-9-3-1-4-10-23;/h2,5-6,8,12,16-17,22H,1,3-4,7,9-11,13,20H2;1H/b5-2+; |
| InChIKey | MLFPGXWTBSRGCK-DPZBITMOSA-N |
| XLogP | 0.86 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|